CymitQuimica logo

CAS 25688-22-6

:

1-(2-Nitrophenyl)-1H-1,2,4-triazole

Description:
1-(2-Nitrophenyl)-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a nitrophenyl group, which contributes to its unique chemical properties and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitro group can impart significant reactivity, making it useful in various chemical reactions, including those in medicinal chemistry and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored for potential pharmaceutical applications. Its molecular structure allows for various functionalization possibilities, enhancing its utility in synthetic chemistry. Safety data should be consulted, as nitro compounds can pose hazards, including toxicity and environmental concerns. Overall, 1-(2-Nitrophenyl)-1H-1,2,4-triazole is a versatile compound with notable characteristics that make it of interest in both research and industrial contexts.
Formula:C8H6N4O2
InChI:InChI=1S/C8H6N4O2/c13-12(14)8-4-2-1-3-7(8)11-6-9-5-10-11/h1-6H
InChI key:InChIKey=VRTXNVSANZBXNW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC=C1)N2C=NC=N2
Synonyms:
  • 1-(2-Nitrophenyl)-1H-1,2,4-triazole
  • 1H-1,2,4-Triazole, 1-(2-nitrophenyl)-
  • 1H-1,2,4-Triazole, 1-(o-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.