CymitQuimica logo

CAS 256922-53-9

:

Thiazolo[4,5-c]quinolin-4-amine, 2-propyl-

Description:
Thiazolo[4,5-c]quinolin-4-amine, 2-propyl- is a heterocyclic compound characterized by its unique structural framework that combines thiazole and quinoline moieties. This compound features a thiazole ring fused to a quinoline structure, with an amino group at the 4-position of the quinoline and a propyl substituent at the 2-position of the thiazole. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as antimicrobial, anticancer, or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Additionally, its molecular structure suggests potential for interactions with various biological targets, which could be explored in drug development. The compound's solubility, stability, and reactivity would also be influenced by its functional groups, making it a candidate for further research in synthetic and pharmaceutical chemistry.
Formula:C13H13N3S
InChI:InChI=1S/C13H13N3S/c1-2-5-10-16-11-12(17-10)8-6-3-4-7-9(8)15-13(11)14/h3-4,6-7H,2,5H2,1H3,(H2,14,15)
InChI key:NFYMGJSUKCDVJR-UHFFFAOYSA-N
SMILES:CCCC1=NC2=C(S1)C3=CC=CC=C3N=C2N
Found 5 products.