CAS 256928-74-2
:(2R)-3-Carboxy-2-(3-carboxy-1-oxopropoxy)-N,N,N-trimethyl-1-propanaminium inner salt
Description:
(2R)-3-Carboxy-2-(3-carboxy-1-oxopropoxy)-N,N,N-trimethyl-1-propanaminium inner salt is a quaternary ammonium compound characterized by its complex structure, which includes multiple functional groups such as carboxylic acids and a quaternary ammonium moiety. This compound is typically soluble in water due to its ionic nature, which enhances its interaction with polar solvents. The presence of carboxylic acid groups contributes to its acidity and potential buffering capacity, making it useful in various biochemical applications. The trimethylammonium group imparts cationic properties, which can facilitate interactions with negatively charged biomolecules, such as nucleic acids and proteins. This compound may exhibit biological activity, potentially serving as a surfactant or a stabilizing agent in formulations. Its inner salt form indicates that it exists in a zwitterionic state, balancing positive and negative charges within the molecule, which can influence its reactivity and solubility. Overall, this compound's unique structural features make it of interest in fields such as medicinal chemistry and biochemistry.
Formula:C11H19NO6
InChI:InChI=1S/C11H19NO6/c1-12(2,3)7-8(6-10(15)16)18-11(17)5-4-9(13)14/h8H,4-7H2,1-3H3,(H-,13,14,15,16)/t8-/m1/s1
InChI key:InChIKey=HAEVNYBCYZZDFL-MRVPVSSYSA-N
SMILES:[C@H](OC(CCC(O)=O)=O)(C[N+](C)(C)C)CC([O-])=O
Synonyms:- (2R)-3-Carboxy-2-(3-carboxy-1-oxopropoxy)-N,N,N-trimethyl-1-propanaminium inner salt
- Succinylcarnitine
- 1-Propanaminium, 3-carboxy-2-(3-carboxy-1-oxopropoxy)-N,N,N-trimethyl-, inner salt, (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Succinyl-L-carnitine-13C3 Chloride
CAS:Controlled ProductFormula:C3C8H20NO6·ClColor and Shape:NeatMolecular weight:300.711
