CAS 256935-99-6

7-Fluoro-1H-indole-5-carboxylic acid

Description:

7-Fluoro-1H-indole-5-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 7-position and a carboxylic acid group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid functionality, which can engage in hydrogen bonding. It may exhibit acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity or altering its biological activity. 7-Fluoro-1H-indole-5-carboxylic acid is of interest in medicinal chemistry and drug development, particularly for its potential applications in pharmaceuticals, where indole derivatives are often explored for their biological activities.

Formula: C₉H₆FNO₂

InChI: InChI=1S/C9H6FNO2/c10-7-4-6(9(12)13)3-5-1-2-11-8(5)7/h1-4,11H,(H,12,13)

InChI key: InChIKey=MYXBVKCHUTXDAR-UHFFFAOYSA-N

SMILES: FC1=C2C(=CC(C(O)=O)=C1)C=CN2

Synonyms:

• 1H-Indole-5-carboxylic acid, 7-fluoro-
• 7-Fluoro-1H-indole-5-carboxylic acid

7-Fluoro-1H-indole-5-carboxylic acid

CAS: 256935-99-6

7-Fluoro-1H-indole-5-carboxylic acid

Purity: ≥95%

Molecular weight: 179.15g/mol

Ref: 54-PC6206

7-Fluoro-1H-indole-5-carboxylic acid

CAS: 256935-99-6

Versatile small molecule scaffold

Formula: C₉H₆FNO₂

Purity: Min. 95%

Molecular weight: 179.15 g/mol

Ref: 3D-GKA93599