CAS 25694-72-8: Lonicerin
Description:Lonicerin, with the CAS number 25694-72-8, is a chemical compound primarily derived from the plant genus Lonicera, commonly known as honeysuckle. It is classified as a flavonoid glycoside, which means it consists of a flavonoid moiety linked to a sugar molecule. Lonicerin is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities. These characteristics make it of interest in both traditional herbal medicine and modern pharmacology. The compound is typically studied for its effects on various biological systems, and it may contribute to the therapeutic benefits associated with honeysuckle extracts. Lonicerin's solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in formulations. As research continues, the full spectrum of its biological activities and potential uses in health and medicine is being explored, highlighting the importance of natural products in drug discovery and development.
Formula:C27H30O15
InChI:InChI=1S/C27H30O15/c1-9-20(33)22(35)24(37)26(38-9)42-25-23(36)21(34)18(8-28)41-27(25)39-11-5-14(31)19-15(32)7-16(40-17(19)6-11)10-2-3-12(29)13(30)4-10/h2-7,9,18,20-31,33-37H,8H2,1H3/t9-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1
InChI key:InChIKey=SHPPXMGVUDNKLV-KMFFXDMSSA-N
SMILES:O=C1C=C(OC2=CC(OC3OC(CO)C(O)C(O)C3OC4OC(C)C(O)C(O)C4O)=CC(O)=C12)C=5C=CC(O)=C(O)C5
- Synonyms:
- Lonicerin
- 7-[[2-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 7-[[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-
- Glucopyranoside, luteolin-7 2-O-(6-deoxy-α-L-mannopyranosyl)-, β-D-
- Flavone, 3′,4′,5,7-tetrahydroxy-, 7-[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside]
