CAS 25696-03-1

Sphingadienine

Description:

Sphingadienine is a bioactive sphingolipid that plays a significant role in cellular signaling and membrane structure. It is characterized by a long hydrocarbon chain with two double bonds in its sphingoid backbone, which contributes to its fluidity and interaction with membrane proteins. This compound is primarily found in various biological systems, particularly in the membranes of cells, where it is involved in processes such as cell growth, differentiation, and apoptosis. Sphingadienine can also serve as a precursor for the synthesis of more complex sphingolipids, influencing various physiological functions. Its structure includes an amine group and hydroxyl groups, which are essential for its biological activity. Additionally, sphingadienine is known to participate in the regulation of inflammatory responses and has been studied for its potential implications in various diseases, including cancer and neurodegenerative disorders. Overall, sphingadienine is an important molecule in the field of biochemistry and cell biology, contributing to our understanding of lipid metabolism and cell signaling pathways.

Formula: C₁₈H₃₅NO₂

InChI: InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h4-5,14-15,17-18,20-21H,2-3,6-13,16,19H2,1H3/b5-4-,15-14+/t17-,18+/m0/s1

InChI key: InChIKey=KWDXKYNWAKMLKK-YQDZIVAPSA-N

SMILES: C(=C/CCCCCCCC/C=C\CCC)\[C@H]([C@H](CO)N)O

Synonyms:

• 4,14-Octadecadiene-1,3-diol, 2-amino-, [R-[R*,S*-(E,Z)]]-
• 4,14-Octadecadiene-1,3-diol, 2-amino-, (2S,3R,4E,14Z)-
• cis-4,14-Sphingadienine
• 4,14-Octadecadiene-1,3-diol, 2-amino-, (E,Z)-D-erythro-
• (2S,3R,4E,14Z)-2-Amino-4,14-octadecadiene-1,3-diol

(4E, 14Z)-Sphingadienine-C18

Controlled Product

CAS: 25696-03-1

Formula: C₁₈H₃₅NO₂

Color and Shape: Neat

Molecular weight: 297.48

Ref: TR-S680630