CAS 25696-57-5
:6-Bromo-2-naphthalenyl α-D-glucopyranoside
Description:
6-Bromo-2-naphthalenyl α-D-glucopyranoside is a chemical compound characterized by its structure, which includes a naphthalene ring substituted at the 6-position with a bromine atom and a glucopyranoside moiety. This compound is typically used in organic synthesis and may serve as a glycoside, where the glucopyranoside part can participate in various chemical reactions, including glycosylation. The presence of the bromine atom can enhance the reactivity of the naphthalene ring, making it useful in electrophilic aromatic substitution reactions. The α-D-glucopyranoside configuration indicates that the glucopyranoside is in the alpha anomeric form, which can influence its biological activity and solubility. This compound may exhibit properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry and biochemistry. As with many organic compounds, safety precautions should be taken when handling it, and its stability under various conditions should be considered in practical applications.
Formula:C16H17BrO6
InChI:InChI=1S/C16H17BrO6/c17-10-3-1-9-6-11(4-2-8(9)5-10)22-16-15(21)14(20)13(19)12(7-18)23-16/h1-6,12-16,18-21H,7H2/t12-,13-,14+,15-,16+/m1/s1
InChI key:InChIKey=NLRXQZJJCPRATR-LJIZCISZSA-N
SMILES:O(C1=CC2=C(C=C1)C=C(Br)C=C2)[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O
Synonyms:- 6-Bromo-2-naphthalenyl α-<span class="text-smallcaps">D</span>-glucopyranoside
- 6-Bromo-2-naphthyl alpha-D-glucopyranoside
- 6-Bromo-2-naphthyl-alpha-glucoside
- 6-Bromo-2-naphthyl-α-<span class="text-smallcaps">D</span>-glucopyranoside
- 6-bromonaphthalen-2-yl (3xi)-alpha-D-ribo-hexopyranoside
- 6-bromonaphthalen-2-yl alpha-D-glucopyranoside
- Glucopyranoside, 6-bromo-2-naphthyl, α-<span class="text-smallcaps">D</span>-
- α-<span class="text-smallcaps">D</span>-Glucopyranoside, 6-bromo-2-naphthalenyl
- α-D-Glucopyranoside, 6-bromo-2-naphthalenyl
- 6-Bromo-2-naphthalenyl α-D-glucopyranoside
- 6-Bromo-2-naphthyl-α-D-glucopyranoside
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-Bromo-2-naphthyl a-D-glucopyranoside
CAS:<p>6-Bromo-2-naphthyl alpha-D-glucopyranoside is a chromogenic substrate used to detect alpha-glucosidase enzyme activity. When cleaved by the enzyme alpha-glucosidase, it releases 6-bromo-2-naphthol, which can be coupled with diazonium salts (for example 4'-amino-2,3'-dimethylazobenzene, also known as Fast Garnet GBC) to form a colored precipitate. 6-Bromo-2-naphthyl alpha-D-glucopyranoside is used in biochemical assays, histochemistry, and diagnostic tests for conditions like lysosomal storage disorders (e.g. Pompe disease) and carbohydrate metabolism studies.</p>Formula:C16H17BrO6Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:385.21 g/mol

