CAS 25699-98-3

1-[4-(1H-pyrazol-1-yl)phenyl]ethanone

Description:

1-[4-(1H-pyrazol-1-yl)phenyl]ethanone, with the CAS number 25699-98-3, is an organic compound characterized by its structure, which includes a pyrazole ring attached to a phenyl group and an ethanone moiety. This compound typically exhibits properties common to ketones, such as being a polar molecule due to the carbonyl group, which can participate in hydrogen bonding. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while its solubility in water may be limited due to its hydrophobic aromatic components. The presence of the pyrazole ring suggests potential biological activity, as pyrazole derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, this compound may undergo typical reactions associated with ketones, including nucleophilic addition and oxidation. Its unique structure makes it of interest in various fields, including organic synthesis and drug development, where it may serve as a building block or a lead compound for further modifications.

Formula: C₁₁H₁₀N₂O

InChI: InChI=1/C11H10N2O/c1-9(14)10-3-5-11(6-4-10)13-8-2-7-12-13/h2-8H,1H3

SMILES: CC(=O)c1ccc(cc1)n1cccn1

Synonyms:

• Ethanone, 1-[4-(1H-pyrazol-1-yl)phenyl]-
• 1-(4-Pyrazol-1-Ylphenyl)Ethanone

4-(1H-Pyrazol-1-yl)acetophenone

CAS: 25699-98-3

Formula: C₁₁H₁₀N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 186.2099

Ref: IN-DA003KLE

4-(1H-Pyrazol-1-yl)acetophenone

CAS: 25699-98-3

4-(1H-Pyrazol-1-yl)acetophenone

Purity: 97%

Molecular weight: 186.2099g/mol

Ref: 54-OR952366

4′-(1-PYRAZOLYL)ACETOPHENONE

CAS: 25699-98-3

Formula: C₁₁H₁₀N₂O

Purity: 98%

Molecular weight: 186.214

Ref: 10-F386953

1-[4-(1H-Pyrazol-1-yl)phenyl]ethanone

CAS: 25699-98-3

1-[4-(1H-Pyrazol-1-yl)phenyl]ethanone is a bipyridine that can be used as a reagent to produce alkenylation products. It has chemoselectivity, meaning it reacts with only one of the two possible functional groups in an organic molecule. 1-[4-(1H-Pyrazol-1-yl)phenyl]ethanone is an oxidant and can be used for ruthenium catalyzed reactions. The compound was also shown to be directive and carboxylic acid catalysis in oxidative solvent systems.

Formula: C₁₁H₁₀N₂O

Purity: Min. 95%

Molecular weight: 186.21 g/mol

Ref: 3D-ABA69998