CAS 25700-04-3

1-[4-(1H-1,2,4-triazol-1-yl)phenyl]ethanone

Description:

1-[4-(1H-1,2,4-triazol-1-yl)phenyl]ethanone, with the CAS number 25700-04-3, is an organic compound characterized by its triazole and ketone functional groups. This compound features a phenyl ring substituted with a triazole moiety, which contributes to its potential biological activity. The presence of the ethanone group indicates that it is a ketone, which typically exhibits reactivity associated with carbonyl compounds, such as nucleophilic addition. The triazole ring is known for its stability and ability to form coordination complexes, making this compound of interest in medicinal chemistry and agricultural applications, particularly as a fungicide or herbicide. Its molecular structure suggests potential interactions with biological targets, which may lead to various pharmacological effects. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the phenyl and triazole rings, making it a subject of study for its synthetic pathways and applications in drug development.

Formula: C₁₀H₉N₃O

InChI: InChI=1/C10H9N3O/c1-8(14)9-2-4-10(5-3-9)13-7-11-6-12-13/h2-7H,1H3

SMILES: CC(=O)c1ccc(cc1)n1cncn1

1-(4-(1H-1,2,4-Triazol-1-yl)phenyl)ethanone

CAS: 25700-04-3

Formula: C₁₀H₉N₃O

Molecular weight: 187.1980

Ref: IN-DA007M93

1-[4-(1H-1,2,4-Triazol-1-yl)phenyl]ethan-1-one

CAS: 25700-04-3

Versatile small molecule scaffold

Formula: C₁₀H₉N₃O

Purity: Min. 95%

Molecular weight: 187.2 g/mol

Ref: 3D-ABA70004