CAS 25700-10-1

1-[4-(1H-benzimidazol-1-yl)phenyl]ethanone

Description:

1-[4-(1H-benzimidazol-1-yl)phenyl]ethanone, with the CAS number 25700-10-1, is an organic compound characterized by its structure, which includes a benzimidazole moiety and an ethanone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the benzimidazole ring suggests that it may have applications in pharmaceuticals, particularly as a scaffold for drug development due to its ability to interact with biological targets. The compound is likely to be soluble in organic solvents, and its stability can be influenced by factors such as pH and temperature. Additionally, it may exhibit fluorescence properties, making it useful in various analytical applications. As with many organic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, 1-[4-(1H-benzimidazol-1-yl)phenyl]ethanone represents a versatile structure with potential implications in medicinal chemistry and material science.

Formula: C₁₅H₁₂N₂O

InChI: InChI=1/C15H12N2O/c1-11(18)12-6-8-13(9-7-12)17-10-16-14-4-2-3-5-15(14)17/h2-10H,1H3

SMILES: CC(=O)c1ccc(cc1)n1cnc2ccccc12

Synonyms:

• ethanone, 1-[4-(1H-benzimidazol-1-yl)phenyl]-

1-[4-(1H-benzimidazol-1-yl)phenyl]ethanone

CAS: 25700-10-1

Molecular weight: 236.2740020751953

Ref: 10-F348180

1-[4-(1H-Benzimidazol-1-yl)phenyl]ethanone

CAS: 25700-10-1

Versatile small molecule scaffold

Formula: C₁₅H₁₂N₂O

Purity: Min. 95%

Molecular weight: 236.27 g/mol

Ref: 3D-ABA70010