
CAS 25702-20-9
:7-Oxabicyclo[4.1.0]heptane, homopolymer
Description:
7-Oxabicyclo[4.1.0]heptane, homopolymer, also known by its CAS number 25702-20-9, is a synthetic polymer characterized by its unique bicyclic structure that incorporates an oxygen atom within its ring system. This polymer is derived from the polymerization of the monomer 7-oxabicyclo[4.1.0]heptane, which features a seven-membered ring with an ether functionality. The polymer exhibits properties typical of polyethers, such as flexibility, chemical resistance, and thermal stability. Its structure allows for potential applications in various fields, including materials science and organic synthesis. The presence of the oxygen atom in the bicyclic framework can enhance solubility in polar solvents and may contribute to its reactivity in certain chemical processes. Additionally, the polymer's mechanical properties can be influenced by its molecular weight and degree of polymerization, making it suitable for applications that require specific performance characteristics. Overall, 7-Oxabicyclo[4.1.0]heptane, homopolymer, represents a versatile compound with potential utility in advanced material applications.
Formula:(C6H10O)x
InChI:InChI=1S/C6H10O/c1-2-4-6-5(3-1)7-6/h5-6H,1-4H2
InChI key:InChIKey=ZWAJLVLEBYIOTI-UHFFFAOYSA-N
SMILES:C12C(O1)CCCC2
Synonyms:- Poly(cyclohexene oxide)
- 7-Oxabicyclo[4.1.0]heptane, polymers
- Poly(oxycyclohexene)
- 7-Oxabicyclo[4.1.0]heptane, homopolymer
- 1,2-Cyclohexene oxide polymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
