CAS 25702-75-4: Polyxylose

Description:Polyxylose, with the CAS number 25702-75-4, is a polysaccharide derived from xylose, a five-carbon sugar. It is characterized by its structural composition, which consists of multiple xylose units linked together through glycosidic bonds. Polyxylose is known for its potential health benefits, particularly as a dietary fiber, as it can promote gut health and support digestive processes. It is soluble in water, which allows it to be utilized in various food and pharmaceutical applications. Additionally, polyxylose exhibits low caloric value, making it an attractive ingredient for low-calorie and sugar-free products. Its ability to form gels and thicken solutions also contributes to its functionality in food formulations. Furthermore, polyxylose is considered safe for consumption and is often used as a bulking agent or sweetener alternative. Overall, its unique properties make polyxylose a versatile compound in both the food industry and health-related applications.

Formula:(C₅H₁₀O₅)x

InChI:InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5+/m0/s1

InChI key:InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N

SMILES:O=CC(O)C(O)C(O)CO