CAS 25710-20-7

5-Chloro-2,3-diaminopyridine

Description:

5-Chloro-2,3-diaminopyridine is an organic compound characterized by its pyridine ring, which is substituted with both amino groups and a chlorine atom. The presence of two amino groups at the 2 and 3 positions of the pyridine ring contributes to its potential as a building block in the synthesis of various pharmaceuticals and agrochemicals. The chlorine atom at the 5 position enhances its reactivity and can influence its biological activity. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, which is common for amine-containing compounds. Its structure allows for hydrogen bonding, which can affect its interactions in biological systems. Additionally, 5-Chloro-2,3-diaminopyridine may have applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₅H₇ClN₃

InChI: InChI=1/C5H6ClN3/c6-3-1-4(7)5(8)9-2-3/h1-2H,7H2,(H2,8,9)/p+1

Synonyms:

• 2,3-Diamino-5-chloropyridine
• 5-Chloropyridine-2,3-Diamine
• 2,3-Diamino-5-Chloropyridinium

5-Chloropyridine-2,3-diamine

CAS: 25710-20-7

Formula: C₅H₆ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.5742

Ref: IN-DA003MOT

5-Chloropyridine-2,3-diamine

CAS: 25710-20-7

5-Chloropyridine-2,3-diamine

Purity: 98%

Molecular weight: 143.57g/mol

Ref: 54-OR40433

5-Chloro-2,3-diaminopyridine

CAS: 25710-20-7

Formula: C₅H₆ClN₃

Molecular weight: 143.58

Ref: 7W-GK2462

2,3-Diamino-5-chloropyridine

CAS: 25710-20-7

2,3-Diamino-5-chloropyridine (2,3-DAP) is a diamine that has been shown to interact with other molecules through hydrogen bonding. It has been shown to be an acceptor in the hydrogen bonding of diazepinones and fluorescence studies. 2,3-DAP has also been used as a starting material in the synthesis of clozapine and imidazoles. The molecule has been studied using electrochemical techniques at different temperatures, including thermally induced hydrogen bond formation.

Formula: C₅H₆ClN₃

Purity: Min. 95%

Molecular weight: 143.57 g/mol

Ref: 3D-FD42917

2,3-Diamino-5-chloropyridine

CAS: 25710-20-7

Formula: C₅H₆ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.57

Ref: 10-F049470