CAS 25712-94-1

4-hydroxy-3-methylphenyl hexopyranoside

Description:

4-Hydroxy-3-methylphenyl hexopyranoside, identified by its CAS number 25712-94-1, is a glycoside compound characterized by the presence of a hexopyranoside sugar moiety linked to a phenolic structure. The compound features a hydroxyl group and a methyl group on the aromatic ring, which contribute to its chemical reactivity and potential biological activity. Glycosides like this one often exhibit solubility in polar solvents due to the sugar component, while the phenolic part may impart antioxidant properties. The presence of the hydroxy and methyl substituents can influence the compound's interaction with biological systems, potentially affecting its pharmacological properties. Such compounds are of interest in various fields, including medicinal chemistry and natural product research, due to their potential therapeutic applications. Additionally, the structural characteristics suggest that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its stability and reactivity in different environments.

Formula: C₁₃H₁₈O₇

InChI: InChI=1/C13H18O7/c1-6-4-7(2-3-8(6)15)19-13-12(18)11(17)10(16)9(5-14)20-13/h2-4,9-18H,5H2,1H3

SMILES: Cc1cc(ccc1O)OC1C(C(C(C(CO)O1)O)O)O

Synonyms:

• Homoarbutin

Homoarbutin

CAS: 25712-94-1

Formula: C₁₃H₁₈O₇

Color and Shape: Solid

Molecular weight: 286.2778

Ref: IN-DA00BFET

Homoarbutin

CAS: 25712-94-1

Formula: C₁₃H₁₈O₇

Molecular weight: 286.28

Ref: 7W-GY1587

Homoarbutin

CAS: 25712-94-1

Homoarbutin is a natural product

Formula: C₁₃H₁₈O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 286.28

Ref: TM-TN1738

Homoarbutin

CAS: 25712-94-1

Formula: C₁₃H₁₈O₇

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 286.28

Ref: BP-BP1606

Homoarbutin

CAS: 25712-94-1

Homoarbutin is a skin-brightening agent, which is sourced from certain plant species known for their medicinal properties. It operates through the inhibition of tyrosinase, an enzyme critical in the biosynthetic pathway of melanin production. By effectively reducing melanin synthesis, Homoarbutin helps mitigate hyperpigmentation and provides a more even skin tone.

Purity: Min. 95%

Ref: 3D-FH137837