
CAS 25718-95-0
:Poly(3-hydroxypropionate)
Description:
Poly(3-hydroxypropionate) (PHP) is a biodegradable polymer belonging to the class of polyhydroxyalkanoates (PHAs), which are produced by certain microorganisms as a means of carbon storage. PHP is characterized by its aliphatic structure, which contributes to its flexibility and thermoplastic properties. It typically exhibits good mechanical strength and can be processed using conventional plastic processing techniques. The polymer is soluble in organic solvents and has a relatively low melting point, making it suitable for various applications, including packaging materials and biomedical devices. PHP is also notable for its biocompatibility and biodegradability, which make it an environmentally friendly alternative to conventional petroleum-based plastics. Its degradation occurs through microbial action, leading to non-toxic byproducts. Additionally, PHP can be synthesized through fermentation processes using renewable resources, aligning with sustainable practices in material production. Overall, poly(3-hydroxypropionate) represents a promising material in the field of green chemistry and sustainable materials science.
Formula:(C3H6O3)x
InChI:InChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6)
InChI key:InChIKey=ALRHLSYJTWAHJZ-UHFFFAOYSA-N
SMILES:C(C(O)=O)CO
Synonyms:- Poly(3-hydroxypropionate)
- Poly(3-hydroxypropionic acid)
- Poly(β-hydroxypropionic acid)
- Propanoic acid, 3-hydroxy-, homopolymer
- 3-Hydroxypropionic acid homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
