CAS 2572-44-3
:6-chloro-N,N'-bis(4-chlorophenyl)-1,3,5-triazine-2,4-diamine
Description:
6-Chloro-N,N'-bis(4-chlorophenyl)-1,3,5-triazine-2,4-diamine, with the CAS number 2572-44-3, is a synthetic organic compound characterized by its triazine core, which features two 4-chlorophenyl groups and two amino groups. This compound exhibits properties typical of triazine derivatives, including potential applications in agrochemicals, particularly as herbicides or fungicides due to its ability to inhibit specific biochemical pathways in plants. The presence of chlorine substituents enhances its biological activity and stability, while the amino groups contribute to its solubility and reactivity. The compound is generally solid at room temperature and may exhibit moderate to high toxicity to aquatic organisms, necessitating careful handling and environmental considerations. Its synthesis typically involves multi-step reactions, and it can be analyzed using techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity. Overall, this compound is of interest in both industrial and research settings, particularly in the fields of chemistry and agriculture.
Formula:C15H10Cl3N5
InChI:InChI=1/C15H10Cl3N5/c16-9-1-5-11(6-2-9)19-14-21-13(18)22-15(23-14)20-12-7-3-10(17)4-8-12/h1-8H,(H2,19,20,21,22,23)
SMILES:c1cc(ccc1Cl)Nc1nc(Cl)nc(Nc2ccc(cc2)Cl)n1
Synonyms:- 1,3,5-Triazine-2,4-diamine, 6-chloro-N~2~,N~4~-bis(4-chlorophenyl)-
- 6-Chloro-N,N'-bis(4-chlorophenyl)-1,3,5-triazine-2,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.