CAS 25724-79-2
:5-Cyano-1-indanone
Description:
5-Cyano-1-indanone is an organic compound characterized by its indanone structure, which features a fused benzene and cyclopentanone ring system. The presence of a cyano group (-C≡N) at the 5-position of the indanone contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid at room temperature and is known for its role in various chemical reactions, including nucleophilic additions and cycloadditions. Its molecular structure allows for the possibility of forming derivatives through substitution reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 5-cyano-1-indanone may exhibit interesting electronic properties due to the conjugation between the cyano group and the aromatic system, which can influence its behavior in chemical reactions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C10H7NO
InChI:InChI=1/C10H7NO/c11-6-7-1-3-9-8(5-7)2-4-10(9)12/h1,3,5H,2,4H2
SMILES:c1cc2c(CCC2=O)cc1C#N
Synonyms:- 1H-indene-5-carbonitrile, 2,3-dihydro-1-oxo-
- 1-Oxoindan-5-carbonitril
- 1-Oxoindane-5-carbonitrile
- 1-oxo-2,3-dihydro-1H-indene-5-carbonitrile
- NSC 225101
- 2,3-Dihydro-1-oxo-1H-indene-5-carbonitrile
- 1-oxo-2,3-dihydroindene-5-carbonitrile
- 5-Isocyano-2,3-dihydroinden-1-one
- 5-Cyano-1-indanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-oxo-2,3-dihydro-1H-indene-5-carbonitrile
CAS:Formula:C10H7NOPurity:95%Color and Shape:SolidMolecular weight:157.16872,3-Dihydro-1-oxo-1H-indene-5-carbonitrile
CAS:2,3-Dihydro-1-oxo-1H-indene-5-carbonitrilePurity:98%Molecular weight:157.17g/mol2,3-Dihydro-1-oxo-1H-indene-5-carbonitrile
CAS:Formula:C10H7NOPurity:95%Color and Shape:Solid, Yellow powderMolecular weight:157.1722,3-Dihydro-1-oxo-1H-indene-5-carbonitrile
CAS:2,3-Dihydro-1-oxo-1H-indene-5-carbonitrile is a chiral, catalytic compound that can be used in the synthesis of natural products and antibiotics. It is a cross-coupling agent that can be used in organic synthesis. This compound has been shown to have antibacterial properties by inhibiting the growth of bacteria such as Mycobacterium tuberculosis and Mycobacterium avium complex. 2,3-Dihydro-1-oxo-1H-indene-5-carbonitrile is also an amine that can undergo amination reactions with carboxylic acid derivatives or ammonia to form heterocycles. The compound can also undergo a nucleophilic substitution reaction with alkyl halides to form new carbon–halogen bonds.
Formula:C10H7NOPurity:Min. 95%Molecular weight:157.17 g/mol




