CAS 25729-13-9
:Dinonyloxybenzene
Description:
Dinonyloxybenzene is an organic compound characterized by its structure, which includes a benzene ring substituted with two long-chain alkoxy groups derived from nonyl alcohol. This compound typically exhibits properties associated with both aromatic compounds and long-chain alkyl groups, such as hydrophobicity and low solubility in water. Dinonyloxybenzene is often used as a surfactant or emulsifier due to its ability to reduce surface tension and stabilize mixtures of oil and water. Its molecular structure contributes to its thermal stability and resistance to oxidation, making it suitable for various industrial applications, including as an additive in lubricants and coatings. Additionally, the presence of the nonyl groups enhances its compatibility with non-polar solvents, further broadening its utility in formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper use and minimize risks.
Formula:C30H46N2O3
InChI:InChI=1/C30H46N2O3/c1-3-5-7-9-11-13-15-25-34-29-21-17-27(18-22-29)31-32(33)28-19-23-30(24-20-28)35-26-16-14-12-10-8-6-4-2/h17-24H,3-16,25-26H2,1-2H3/b32-31-
Synonyms:- 4,4-Di-n-nonyloxybenzene
- 1-(nonyloxy)-4-{(Z)-[4-(nonyloxy)phenyl]-NNO-azoxy}benzene
- 4,4'-Dinonyloxyazoxybenzene
- 4,4'-DI-N-NONYLOXYAZOXYBENZENE
- 1,2-Bis(4-(nonyloxy)phenyl)diazene oxide
- 4,4'-Bis(nonyloxy)azoxybenzene
- Diazene, 1,2-bis[4-(nonyloxy)phenyl]-, 1-oxide
- 4,4'-DI-N-NONYLOXYAZOBENZENE
- Dinonyloxybenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

