CAS 25739-41-7
:Velutin
Description:
Velutin, with the CAS number 25739-41-7, is a flavonoid compound primarily found in various plant species. It is characterized by its yellow to orange pigmentation, which is typical of many flavonoids, and it exhibits antioxidant properties, contributing to its potential health benefits. Velutin is known for its ability to scavenge free radicals, thereby protecting cells from oxidative stress. Additionally, it may possess anti-inflammatory and antimicrobial activities, making it of interest in both nutritional and pharmaceutical research. The compound's solubility can vary depending on the solvent used, and it is often studied in the context of its bioavailability and metabolic pathways. As a natural product, Velutin is also being explored for its potential applications in food preservation and as a dietary supplement. Overall, its diverse biological activities and natural origin make Velutin a subject of ongoing scientific investigation.
Formula:C17H14O6
InChI:InChI=1/C17H14O6/c1-21-10-6-12(19)17-13(20)8-14(23-16(17)7-10)9-3-4-11(18)15(5-9)22-2/h3-8,18-19H,1-2H3
InChI key:InChIKey=ROCUOVBWAWAQFD-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(OC)=C(O)C=C3)=CC(OC)=CC2O
Synonyms:- 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-
- Flavone, 4′,5-dihydroxy-3′,7-dimethoxy-
- Velutin
- Flavoyadorigenin B
- 7,3'- Di-O- methylluteolin
- 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxychromen-4-one
- 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-chromen-4-one
- 2-(3-Methoxy-4-hydroxyphenyl)-7-methoxy-5-hydroxy-4H-1-benzopyran-4-one
- 4',5-Dihydroxy-3',7-dimethoxyflavone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4',5-Dihydroxy-3',7-dimethoxyflavone
CAS:Formula:C17H14O6Purity:95%Color and Shape:SolidMolecular weight:314.2895Velutin
CAS:Velutin shows the strongest inhibitory effect in NF-κB activation and exhibits the greatest effects in blocking the degradation of inhibitor of NF-κB as well asFormula:C17H14O6Purity:99.69%Color and Shape:SolidMolecular weight:314.29Velutin
CAS:Velutin is a natural flavonoid, which is derived from the leaves of certain plant species, specifically from the Asteraceae family. This compound demonstrates a unique mode of action by modulating various signaling pathways involved in inflammation and oxidative stress. Velutin effectively inhibits the activation of nuclear factor kappa-light-chain-enhancer of activated B cells (NF-κB) and reduces the expression of pro-inflammatory cytokines, contributing to its anti-inflammatory properties.
Formula:C17H14O6Purity:Min. 95%Color and Shape:PowderMolecular weight:314.29 g/mol






