CAS 25746-85-4

2-Oxa-5-azabicyclo[2.2.1]heptan-3-one

Description:

2-Oxa-5-azabicyclo[2.2.1]heptan-3-one, with the CAS number 25746-85-4, is a bicyclic compound characterized by its unique structural features, which include a nitrogen atom and an oxygen atom incorporated into its bicyclic framework. This compound exhibits a bicyclo[2.2.1] structure, which consists of two bridged carbon rings, contributing to its rigidity and potential for specific interactions in biological systems. The presence of the carbonyl group (ketone) at the 3-position enhances its reactivity, making it a potential candidate for various chemical transformations. Additionally, the nitrogen atom introduces basicity and can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound may be of interest in medicinal chemistry and drug design due to its structural properties, which could lead to the development of novel therapeutic agents. Its unique bicyclic structure and functional groups suggest potential applications in various fields, including organic synthesis and pharmacology.

Formula: C₅H₇NO₂

InChI: InChI=1S/C5H7NO2/c7-5-4-1-3(8-5)2-6-4/h3-4,6H,1-2H2

InChI key: InChIKey=WAWSGFGXFSUXIA-UHFFFAOYSA-N

SMILES: O=C1C2CC(O1)CN2

Synonyms:

• 2-Oxa-5-azabicyclo[2.2.1]heptan-3-one
• Proline, 4-hydroxy-, γ-lactone

2-Oxa-5-azabicyclo[2.2.1]heptan-3-one hydrochloride

CAS: 25746-85-4

Please enquire for more information about 2-Oxa-5-azabicyclo[2.2.1]heptan-3-one hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₅H₇NO₂•HCl

Purity: Min. 95%

Molecular weight: 149.6 g/mol

Ref: 3D-FO184104