CAS 25746-87-6
:4-(dimethoxymethyl)pyrimidine
Description:
4-(Dimethoxymethyl)pyrimidine is an organic compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The presence of the dimethoxymethyl group at the 4-position of the pyrimidine ring enhances its solubility and reactivity, making it a valuable intermediate in organic synthesis. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in pharmaceuticals and agrochemicals, particularly as a building block for the synthesis of various biologically active molecules. The compound's chemical properties include moderate polarity due to the methoxy groups, which can participate in hydrogen bonding. Additionally, it may exhibit moderate stability under standard conditions but should be handled with care due to potential reactivity with strong acids or bases. As with many organic compounds, proper safety measures should be taken when handling 4-(dimethoxymethyl)pyrimidine to avoid exposure and ensure safe laboratory practices.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c1-10-7(11-2)6-3-4-8-5-9-6/h3-5,7H,1-2H3
SMILES:COC(c1ccncn1)OC
Synonyms:- Pyrimidine, 4-(dimethoxymethyl)-
- 4-Dimethoxymethylpyrimidine
- 4-(Dimethoxymethyl)pyrimidine
- 4-DiMethoxyMethyl-pyriMidine 97%
- 4-PYRIMIDINECARBOXALDEHYDE, DIMETHYL ACETAL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Dimethoxymethylpyrimidine
CAS:Formula:C7H10N2O2Purity:97%Color and Shape:LiquidMolecular weight:154.16654-(Dimethoxymethyl)pyrimidine
CAS:4-(Dimethoxymethyl)pyrimidinePurity:98%Molecular weight:154.17g/mol4-Dimethoxymethylpyrimidine
CAS:Formula:C7H10N2O2Purity:97%Color and Shape:LiquidMolecular weight:154.1694-(Dimethoxymethyl)pyrimidine
CAS:4-(Dimethoxymethyl)pyrimidine is a nitrogen heterocycle that is prepared by the reaction of formamide and nitrate. This compound has been shown to inhibit the replication of viruses such as HIV, herpes simplex virus type 2 (HSV-2), or vesicular stomatitis virus (VSV). 4-(Dimethoxymethyl)pyrimidine also binds to uracil in RNA, inhibiting RNA synthesis and leading to cell death. This compound can also be used as a precursor for the preparation of 2-aminopyrimidine, which is used in the synthesis of other compounds. 4-(Dimethoxymethyl)pyrimidine is used in organic synthesis for the preparation of benzene derivatives, such as nitrobenzene. This compound can also be synthesized by reacting formamide with toluene in an ultrasonic bath.Formula:C7H10N2O2Purity:Min. 95%Molecular weight:154.17 g/mol



