CAS 25747-67-5

2-Propen-1-ol, 2-methyl-, homopolymer

Description:

2-Propen-1-ol, 2-methyl-, homopolymer, commonly known as poly(2-methyl-2-propen-1-ol) or polyisobutylene, is a synthetic polymer characterized by its hydrophilic nature and high molecular weight. This polymer is derived from the polymerization of 2-methyl-2-propen-1-ol (also known as isobutylene) and exhibits properties such as flexibility, low density, and resistance to moisture. It is typically colorless and odorless, making it suitable for various applications, including adhesives, coatings, and sealants. The polymer's structure contributes to its thermal stability and chemical resistance, allowing it to perform well in diverse environments. Additionally, it can be modified to enhance specific properties, such as adhesion and compatibility with other materials. Due to its non-toxic nature, it is often used in consumer products and medical applications. Overall, 2-Propen-1-ol, 2-methyl-, homopolymer is valued for its versatility and performance in industrial and commercial applications.

Formula: (C₄H₈O)x

InChI: InChI=1S/C4H8O/c1-4(2)3-5/h5H,1,3H2,2H3

InChI key: InChIKey=BYDRTKVGBRTTIT-UHFFFAOYSA-N

SMILES: C(CO)(C)=C

Synonyms:

• Methallyl alcohol homopolymer
• 2-Propen-1-ol, 2-methyl-, homopolymer
• 2-Propen-1-ol, 2-methyl-, polymers
• Poly(methallyl alcohol)

2-Propen-1-ol, 2-methyl-, homopolymer

CAS: 25747-67-5

Formula: C₄H₈O

Molecular weight: 72.1057

Ref: IN-DA01X3T1