CAS 25753-15-5
:3-(trifluoromethyl)benzoic anhydride
Description:
3-(Trifluoromethyl)benzoic anhydride is an organic compound characterized by its anhydride functional group and the presence of a trifluoromethyl group attached to a benzoic acid structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its high reactivity, particularly in acylation reactions, due to the electrophilic nature of the anhydride carbonyl groups. The trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and stability, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. Additionally, 3-(trifluoromethyl)benzoic anhydride may exhibit moderate toxicity and should be handled with care, following appropriate safety protocols. Its unique properties make it a valuable intermediate in organic synthesis, particularly in the development of fluorinated compounds. As with many anhydrides, it can react with water to form the corresponding carboxylic acid, releasing heat in the process.
Formula:C16H8F6O3
InChI:InChI=1/C16H8F6O3/c17-15(18,19)11-5-1-3-9(7-11)13(23)25-14(24)10-4-2-6-12(8-10)16(20,21)22/h1-8H
SMILES:c1cc(cc(c1)C(F)(F)F)C(=O)OC(=O)c1cccc(c1)C(F)(F)F
Synonyms:- Fxffr Cvovr Cxfff
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Trifluoromethylbenzoic anhydride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C16H8F6O3Purity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:362.23

