CAS 25756-36-9
:Methanamine-15N, N,N-dimethyl-
Description:
Methanamine-15N, N,N-dimethyl- (CAS 25756-36-9) is a nitrogen-labeled organic compound that belongs to the class of amines. It features a central carbon atom bonded to two methyl groups and an amino group, with the nitrogen atom being isotopically labeled with nitrogen-15 (15N), which is a stable isotope of nitrogen. This labeling is often utilized in various research applications, particularly in studies involving metabolic pathways, tracer studies, and NMR spectroscopy, as it allows for the tracking of nitrogen in biological systems. The compound is typically a colorless liquid or solid at room temperature and is soluble in water and organic solvents. Its chemical properties include basicity due to the presence of the amine group, which can participate in hydrogen bonding and nucleophilic reactions. Methanamine-15N, N,N-dimethyl- is used in various fields, including pharmaceuticals and biochemistry, for its role in synthesizing other compounds and as a research tool in understanding nitrogen metabolism.
Formula:C3H9N
InChI:InChI=1S/C3H9N/c1-4(2)3/h1-3H3/i4+1
InChI key:InChIKey=GETQZCLCWQTVFV-AZXPZELESA-N
SMILES:[15N](C)(C)C
Synonyms:- Methanamine-15N, N,N-dimethyl-
- Trimethylamine-15N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
