CAS 257613-44-8

4-Oxobenzofuro[3,2-d]pyrimidine-3(4H)-acetic acid

Description:

4-Oxobenzofuro[3,2-d]pyrimidine-3(4H)-acetic acid is a heterocyclic compound characterized by its complex fused ring structure, which incorporates both benzofuro and pyrimidine moieties. This compound features a ketone functional group and a carboxylic acid group, contributing to its potential reactivity and solubility properties. The presence of these functional groups suggests that it may exhibit acidic behavior and could participate in various chemical reactions, such as esterification or amidation. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry and drug development. The compound's molecular weight, solubility in various solvents, and stability under different conditions would be important factors to consider in practical applications. Additionally, its CAS number, 257613-44-8, allows for easy identification and reference in chemical databases and literature. Overall, 4-Oxobenzofuro[3,2-d]pyrimidine-3(4H)-acetic acid represents a fascinating subject for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₈N₂O₄

InChI: InChI=1S/C12H8N2O4/c15-9(16)5-14-6-13-10-7-3-1-2-4-8(7)18-11(10)12(14)17/h1-4,6H,5H2,(H,15,16)

InChI key: InChIKey=CCLZWLMZZHIGPX-UHFFFAOYSA-N

SMILES: O=C1C2=C(C=3C(O2)=CC=CC3)N=CN1CC(O)=O

Synonyms:

• Benzofuro[3,2-d]pyrimidine-3(4H)-acetic acid, 4-oxo-
• 4-Oxobenzofuro[3,2-d]pyrimidine-3(4H)-acetic acid

(4-Oxo[1]benzofuro[3,2-d]pyrimidin-3(4H)-yl)acetic acid

Controlled Product

CAS: 257613-44-8

4-Oxo-[1]benzofuro[3,2-d]pyrimidin-3(4H)-yl)acetic acid (OBF) is a synthetic ligand that binds to the GABA receptor and inhibits its function. OBF is an antagonist of the GABAA receptor. It has been shown to inhibit the activity of ion channels in cells. In addition, OBF is a selective ligand for the GABAA receptor and has been used as a research tool for studying protein interactions. OBF is also used as a reagent in antibody production.

Formula: C₁₂H₈N₂O₄

Purity: Min. 95%

Molecular weight: 244.2 g/mol

Ref: 3D-HKA61344