CAS 257625-01-7

2-{[4-(trifluoromethyl)pyridin-2-yl]oxy}ethyl 4-methyl-1,2,3-thiadiazole-5-carboxylate

Description:

The chemical substance known as 2-{[4-(trifluoromethyl)pyridin-2-yl]oxy}ethyl 4-methyl-1,2,3-thiadiazole-5-carboxylate is characterized by its complex molecular structure, which includes a thiadiazole ring, an ether linkage, and a trifluoromethyl-substituted pyridine moiety. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of the trifluoromethyl group, which can enhance its biological activity and solubility in organic solvents. The thiadiazole ring contributes to its potential as a bioactive molecule, often associated with various pharmacological activities. Additionally, the ester functional group in the carboxylate portion may influence its reactivity and stability. The presence of multiple functional groups suggests that this compound could participate in various chemical reactions, making it of interest in medicinal chemistry and material science. Its specific applications would depend on further studies, including its interaction with biological targets and its overall toxicity profile.

Formula: C₁₂H₁₀F₃N₃O₃S

InChI: InChI=1/C12H10F3N3O3S/c1-7-10(22-18-17-7)11(19)21-5-4-20-9-6-8(2-3-16-9)12(13,14)15/h2-3,6H,4-5H2,1H3

SMILES: Cc1c(C(=O)OCCOc2cc(ccn2)C(F)(F)F)snn1

2-{[4-(trifluoromethyl)-2-pyridyl]oxy}ethyl 4-methyl-1,2,3-thiadiazole-5-carboxylate

CAS: 257625-01-7

2-{[4-(trifluoromethyl)-2-pyridyl]oxy}ethyl 4-methyl-1,2,3-thiadiazole-5-carboxylate

Purity: ≥95%

Molecular weight: 333.29g/mol

Ref: 54-PC32410