CAS 25768-33-6
:12-Aminododecanoic acid homopolymer
Description:
12-Aminododecanoic acid homopolymer, identified by its CAS number 25768-33-6, is a synthetic polymer derived from the polymerization of 12-aminododecanoic acid, an amino acid with a long aliphatic chain. This polymer exhibits characteristics typical of polyamides, including good mechanical strength, thermal stability, and resistance to chemical degradation. Its structure incorporates both hydrophilic amine groups and hydrophobic dodecanoic acid segments, which can impart unique properties such as enhanced solubility in polar solvents and potential biocompatibility. The presence of amino groups allows for further functionalization, making it suitable for various applications in fields such as biomedical engineering, coatings, and adhesives. Additionally, the polymer's molecular weight and degree of polymerization can significantly influence its physical properties, including viscosity and melting point. Overall, 12-aminododecanoic acid homopolymer represents a versatile material with potential uses in diverse industrial and research applications.
Formula:(C12H25NO2)x
InChI:InChI=1S/C12H25NO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-11,13H2,(H,14,15)
InChI key:InChIKey=PBLZLIFKVPJDCO-UHFFFAOYSA-N
SMILES:C(CCCCCCCCN)CCC(O)=O
Synonyms:- 12-Aminododecanoic acid polymer
- Dodecanoic acid, 12-amino-, polyamides
- Poly(12-aminolauric acid)
- Poly(ω-aminododecanoic acid)
- Dodecanoic acid, 12-amino-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
