CAS 2577-52-8
:4-[(Dipropylamino)sulfonyl]-2-nitrobenzoic acid
Description:
4-[(Dipropylamino)sulfonyl]-2-nitrobenzoic acid, with the CAS number 2577-52-8, is a chemical compound characterized by its sulfonamide functional group and a nitro group attached to a benzoic acid structure. This compound typically exhibits properties associated with both acidic and basic functionalities due to the carboxylic acid group and the dipropylamino moiety. It is generally soluble in polar organic solvents and may have limited solubility in water, depending on the pH. The presence of the nitro group contributes to its electron-withdrawing characteristics, which can influence its reactivity and interactions in various chemical environments. This compound is often utilized in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its specific applications may include serving as an intermediate in drug synthesis or as a reagent in organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H18N2O6S
InChI:InChI=1S/C13H18N2O6S/c1-3-7-14(8-4-2)22(20,21)10-5-6-11(13(16)17)12(9-10)15(18)19/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17)
InChI key:InChIKey=QVUYRWCZUQUOMI-UHFFFAOYSA-N
SMILES:S(N(CCC)CCC)(=O)(=O)C1=CC(N(=O)=O)=C(C(O)=O)C=C1
Synonyms:- 2-Nitroprobenecid
- Benzoic acid, 4-[(dipropylamino)sulfonyl]-2-nitro-
- Benzoic acid, 4-(dipropylsulfamoyl)-2-nitro-
- 4-[(Dipropylamino)sulfonyl]-2-nitrobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Nitroprobenecid
CAS:Controlled Product<p>Applications 2-Nitroprobenecidis an analog of Probenecid (P755000), a uricosuric agent. It’s renal clearance is greater than that of 2-hydroxy or 2-chloroprobenecid.<br>References Blanchard, K.C. et al.: J. Pharmacol. Exp. Ther., 180. 397 (1972);<br></p>Formula:C13H18N2O6SColor and Shape:NeatMolecular weight:330.362-Nitroprobenecid-d14
CAS:Controlled ProductFormula:C13D14H4N2O6SColor and Shape:NeatMolecular weight:344.443
