CAS 25775-85-3
:9-(2-deoxypentofuranosyl)-N-(3-methylbut-2-en-1-yl)-9H-purin-6-amine
Description:
The chemical substance known as "9-(2-deoxypentofuranosyl)-N-(3-methylbut-2-en-1-yl)-9H-purin-6-amine," with the CAS number 25775-85-3, is a nucleoside analog that features a purine base linked to a deoxypentofuranosyl sugar moiety. This compound is characterized by its structural components, which include a purine ring system and an alkyl side chain, specifically a 3-methylbut-2-en-1-yl group. The presence of the deoxyribose sugar suggests that it may play a role in nucleic acid metabolism or function as a potential antiviral or anticancer agent. Its unique structure allows for interactions with biological macromolecules, potentially influencing nucleic acid synthesis or function. The compound's properties, such as solubility, stability, and reactivity, would be influenced by its functional groups and overall molecular architecture. As a nucleoside analog, it may exhibit biological activity by mimicking natural nucleosides, which could lead to therapeutic applications in molecular biology or pharmacology.
Formula:C15H21N5O3
InChI:InChI=1/C15H21N5O3/c1-9(2)3-4-16-14-13-15(18-7-17-14)20(8-19-13)12-5-10(22)11(6-21)23-12/h3,7-8,10-12,21-22H,4-6H2,1-2H3,(H,16,17,18)
SMILES:CC(=CCNc1c2c(ncn1)n(cn2)C1CC(C(CO)O1)O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N6-Isopentenyl-2'-deoxyadenosine
CAS:N6-Isopentenyl-2'-deoxyadenosine is a Nucleoside Derivative - 6-Modified purine nucleoside.Formula:C15H21N5O3Color and Shape:SolidMolecular weight:319.36Ref: TM-TNU1270
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire2’-Deoxy-N6-isopentenyladenosine
CAS:2’-Deoxy-N6-isopentenyladenosine (2’-DIA) is a monophosphate nucleoside that has antiviral properties. It activates DNA polymerase and inhibits tumor proliferation by inhibiting the synthesis of RNA and DNA. 2’-DIA is an analog of adenosine, which is used in the anticancer drug gemcitabine. 2’-DIA is synthesized through the condensation of 6-(2'-deoxyisopentenyl)adenosine with diphosphate. This compound also functions as a ribonucleotide, meaning it can be incorporated into RNA chains to form new proteins.Purity:Min. 95%

