CAS 2578-81-6

phe-phe-phe

Description:

The chemical substance known as "phe-phe-phe," with the CAS number 2578-81-6, is a tripeptide composed of three phenylalanine amino acids linked together. This compound is characterized by its hydrophobic nature due to the presence of the aromatic phenylalanine residues, which can influence its solubility and interactions in biological systems. The structure of this tripeptide allows for potential applications in various fields, including biochemistry and pharmaceuticals, particularly in studies related to protein folding and stability. Additionally, the presence of multiple phenylalanine units may contribute to its ability to form specific interactions with other biomolecules, making it of interest in the design of peptide-based drugs or as a model for understanding peptide behavior. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in experimental settings. Overall, phe-phe-phe serves as a valuable compound for research in peptide chemistry and related disciplines.

Formula: C₂₇H₂₉N₃O₄

InChI: InChI=1/C27H29N3O4/c28-22(16-19-10-4-1-5-11-19)25(31)29-23(17-20-12-6-2-7-13-20)26(32)30-24(27(33)34)18-21-14-8-3-9-15-21/h1-15,22-24H,16-18,28H2,(H,29,31)(H,30,32)(H,33,34)/t22-,23-,24-/m0/s1

SMILES: c1ccc(cc1)C[C@@H](C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](Cc1ccccc1)C(=O)O)O)O)N

Synonyms:

• H-Phe-Phe-Phe-OH
• L-phenylalanyl-L-phenylalanyl-L-phenylalanine

H-Phe-Phe-Phe-OH

CAS: 2578-81-6

FFF is a bitter-tasting peptide due to its hydrophobicity. As diphenylalanine, triphenylalanine forms ordered nanostructures.

Formula: C₂₇H₂₉N₃O₄

Purity: > 98%

Color and Shape: White Powder

Molecular weight: 459.55

Ref: 01-4011114

H-Phe-Phe-Phe-OH

CAS: 2578-81-6

Formula: C₂₇H₂₉N₃O₄

Molecular weight: 459.5369

Ref: IN-DA007LZR

H-Phe-Phe-Phe-OH

CAS: 2578-81-6

H-Phe-Phe-Phe-OH is a molecule that belongs to the class of imidazolidinones. It is synthesized by reacting an amide with an imine. This synthetic molecule has been shown to have antihypertensive effects in a model system for hypertension. H-Phe-Phe-Phe-OH does not have any isomeric forms, but it can be present as different isotopic forms. The constant of this molecule is 2.5 kcal/mol and the molecular weight is 226 g/mol.br>
br>
The molecules are represented by 3D structures, which show their spatial arrangements and interactions with other atoms in space. These structures can be calculated using molecular modeling techniques such as computational chemistry or quantum mechanics.br>
br>
Molecular modeling techniques have allowed researchers to design new molecules, predict their properties and evaluate their potential applications in medicine and other fields.

Formula: C₂₇H₂₉N₃O₄

Purity: Min. 95%

Molecular weight: 459.54 g/mol

Ref: 3D-FP109294