CAS 2578-84-9
:N-[(Phenylmethoxy)carbonyl]-L-phenylalanine 4-nitrophenyl ester
Description:
N-[(Phenylmethoxy)carbonyl]-L-phenylalanine 4-nitrophenyl ester, with CAS number 2578-84-9, is a chemical compound that belongs to the class of amino acid derivatives. It features a phenylalanine backbone, which is an essential amino acid, modified with a phenylmethoxycarbonyl (Pmc) protecting group and a 4-nitrophenyl ester moiety. This compound is typically used in peptide synthesis and as a building block in organic chemistry due to its ability to undergo various chemical transformations. The presence of the nitrophenyl group can enhance the compound's reactivity, making it useful in coupling reactions. Additionally, the Pmc group serves as a protective group that can be removed under specific conditions, allowing for selective functionalization of the amino acid. The compound is generally stable under standard laboratory conditions but should be handled with care due to the potential reactivity of its functional groups. Its applications extend to biochemical research and the development of pharmaceuticals, particularly in the synthesis of peptide-based drugs.
Formula:C23H20N2O6
InChI:InChI=1S/C23H20N2O6/c26-22(31-20-13-11-19(12-14-20)25(28)29)21(15-17-7-3-1-4-8-17)24-23(27)30-16-18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H,24,27)/t21-/m0/s1
InChI key:InChIKey=TVENQUPLPBPLGU-NRFANRHFSA-N
SMILES:[C@H](CC1=CC=CC=C1)(C(OC2=CC=C(N(=O)=O)C=C2)=O)NC(OCC3=CC=CC=C3)=O
Synonyms:- (4-Nitrophenyl) (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate
- 4-nitrophenyl N-[(benzyloxy)carbonyl]-L-phenylalaninate
- 4-nitrophenyl N-[(benzyloxy)carbonyl]phenylalaninate
- <span class="text-smallcaps">L</span>-Phenylalanine, N-[(phenylmethoxy)carbonyl]-, 4-nitrophenyl ester
- Alanine, N-carboxy-3-phenyl-, N-benzyl p-nitrophenyl ester, <span class="text-smallcaps">L</span>-
- N-(Benzyloxycarbonyl)-<span class="text-smallcaps">L</span>-phenylalanine p-nitrophenyl ester
- N-(Benzyloxycarbonyl)phenylalanine 4-nitrophenyl ester
- N-(Benzyloxycarbonyl)phenylalanine p-nitrophenyl ester
- N-(Carbobenzoxy)phenylalanine p-nitrophenyl ester
- N-CBZ-L-Phenylalanine p-nitrophenyl ester N-Carbobenzyloxy-L-phenylalanine p-nitrophenyl ester
- N-Carbobenzoxy-<span class="text-smallcaps">L</span>-phenylalanine p-nitrophenyl ester
- N-[(Phenylmethoxy)carbonyl]-<span class="text-smallcaps">L</span>-phenylalanine 4-nitrophenyl ester
- N-α-Carbobenzoxy-<span class="text-smallcaps">L</span>-phenylalanine p-nitrophenyl ester
- Z-Phe-ONp
- p-Nitrophenyl N-(benzyloxycarbonyl)-<span class="text-smallcaps">L</span>-2-amino-3-phenylpropionate
- p-Nitrophenyl N-carbobenzoxy-<span class="text-smallcaps">L</span>-phenylalaninate
- N-[(Phenylmethoxy)carbonyl]-L-phenylalanine 4-nitrophenyl ester
- p-Nitrophenyl N-(benzyloxycarbonyl)-L-2-amino-3-phenylpropionate
- Alanine, N-carboxy-3-phenyl-, N-benzyl p-nitrophenyl ester, L-
- p-Nitrophenyl N-carbobenzoxy-L-phenylalaninate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Nitrophenyl ((benzyloxy)carbonyl)-L-phenylalaninate
CAS:4-Nitrophenyl ((benzyloxy)carbonyl)-L-phenylalaninatePurity:98%Molecular weight:420.42g/molZ-PHE-ONP
CAS:Controlled ProductApplications Z-PHE-ONP (cas# 2578-84-9) is a useful research chemical.
Formula:C23H20N2O6Color and Shape:NeatMolecular weight:420.41Z-L-Phenylalanine-4-Nitrophenyl Ester extrapure, 98%
CAS:Formula:C23H20N2O6Purity:min. 98 %Color and Shape:White to off-white, Amorphous powder, Clear, Colourless to pale yellowMolecular weight:420.41





