CAS 25781-99-1
:3-(2-Hydroxyethoxy)benzoic acid
Description:
3-(2-Hydroxyethoxy)benzoic acid, with the CAS number 25781-99-1, is an organic compound characterized by its benzoic acid structure modified with a hydroxyethoxy group at the meta position. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyethoxy group, which enhances its hydrophilicity. The presence of the carboxylic acid functional group contributes to its acidity and potential reactivity, allowing it to participate in various chemical reactions, such as esterification or amidation. Its hydroxyethoxy substituent can also engage in hydrogen bonding, influencing its physical properties and interactions with other molecules. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its functional versatility. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Overall, 3-(2-Hydroxyethoxy)benzoic acid exemplifies a compound with diverse chemical properties and potential applications in various fields.
Formula:C9H10O4
InChI:InChI=1/C9H10O4/c10-4-5-13-8-3-1-2-7(6-8)9(11)12/h1-3,6,10H,4-5H2,(H,11,12)
InChI key:InChIKey=VETJNXLHVDPVOS-UHFFFAOYSA-N
SMILES:O(CCO)C1=CC(C(O)=O)=CC=C1
Synonyms:- 3-(2-Hydroxy-ethoxy)-benzoic acid
- Benzoic acid, 3-(2-hydroxyethoxy)-
- NSC 137280
- 3-(2-Hydroxyethoxy)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(2-Hydroxy-ethoxy)-benzoic acid
CAS:3-(2-Hydroxy-ethoxy)-benzoic acidPurity:95%Molecular weight:182.17g/mol3-(2-Hydroxy-ethoxy)-benzoic acid
CAS:3-(2-Hydroxy-ethoxy)-benzoic acid (3HBA) is a deprotonating agent that reacts with organolithiums, organomercurials, and mercuric halides to form their corresponding Grignard reagents. 3HBA also reacts with benzophenone to form benzonitrile. 3HBA can be used for the synthesis of various organic compounds, such as chlorides, yields, and methylcyclohexane. 3HBA has been shown to have a crystallographic structure of C20H22O4Cl. The chloride anion in the crystal lattice is coordinated by two magnesium ions. Mercuric chloride can be prepared from 3HBA by treatment with chlorine gas at elevated temperatures.Formula:C9H10O4Purity:Min. 95%Molecular weight:182.17 g/mol


