CAS 25784-84-3
:1-[(4-methoxyphenyl)sulfanyl]propan-2-one
Description:
1-[(4-Methoxyphenyl)sulfanyl]propan-2-one, with the CAS number 25784-84-3, is an organic compound characterized by its unique functional groups. It features a propan-2-one backbone, which is a ketone, indicating the presence of a carbonyl group (C=O) adjacent to a sulfur atom bonded to a phenyl ring that is further substituted with a methoxy group (-OCH3). This structure imparts specific chemical properties, such as potential reactivity in nucleophilic substitution reactions due to the presence of the sulfur atom, which can act as a leaving group. The methoxy group enhances the electron density on the aromatic ring, influencing its reactivity and stability. The compound may exhibit moderate solubility in organic solvents and could participate in various chemical reactions, including oxidation and reduction processes. Additionally, its structural features suggest potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C10H12O2S
InChI:InChI=1/C10H12O2S/c1-8(11)7-13-10-5-3-9(12-2)4-6-10/h3-6H,7H2,1-2H3
SMILES:CC(=O)CSc1ccc(cc1)OC
Synonyms:- 1-[(4-Methoxyphenyl)sulfanyl]acetone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
