CAS 25786-09-8

N-(4-aminophenyl)-N~2~,N~2~-dimethylglycinamide

Description:

N-(4-aminophenyl)-N2,N2-dimethylglycinamide, identified by its CAS number 25786-09-8, is an organic compound characterized by its amine and amide functional groups. This substance features a dimethylglycinamide backbone, which is modified by the presence of a 4-aminophenyl group, contributing to its potential biological activity. The compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its amine content. Its structure suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. N-(4-aminophenyl)-N2,N2-dimethylglycinamide may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific applications and biological effects would depend on further empirical studies. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a class of molecules that may have significant implications in various chemical and biological contexts.

Formula: C₁₀H₁₅N₃O

InChI: InChI=1/C10H15N3O/c1-13(2)7-10(14)12-9-5-3-8(11)4-6-9/h3-6H,7,11H2,1-2H3,(H,12,14)

SMILES: CN(C)CC(=O)Nc1ccc(cc1)N

Synonyms:

• acetamide, N-(4-aminophenyl)-2-(dimethylamino)-

N~1~-(4-aminophenyl)-N~2~,N~2~-dimethylglycinamide

CAS: 25786-09-8

Formula: C₁₀H₁₅N₃O

Color and Shape: Solid

Molecular weight: 193.2456

Ref: IN-DA007LZX

N-(4-aminophenyl)-N2,N2-dimethylglycinamide

Controlled Product

CAS: 25786-09-8

Applications N-(4-aminophenyl)-N2,N2-dimethylglycinamide (cas# 25786-09-8) is a useful research chemical.

Formula: C₁₀H₁₅N₃O

Color and Shape: Neat

Molecular weight: 193.25

Ref: TR-B413630

N-(4-Aminophenyl)-2-(dimethylamino)acetamide

CAS: 25786-09-8

Versatile small molecule scaffold

Formula: C₁₀H₁₅N₃O

Purity: Min. 95%

Molecular weight: 193.25 g/mol

Ref: 3D-ABA78609