CymitQuimica logo

CAS 257880-90-3

:

[3,5-Bis(trifluoromethyl)phenyl][4-(trifluoromethoxy)phenyl]methanone

Description:
[3,5-Bis(trifluoromethyl)phenyl][4-(trifluoromethoxy)phenyl]methanone, with CAS number 257880-90-3, is an organic compound characterized by its complex structure featuring multiple trifluoromethyl and trifluoromethoxy groups. This compound typically exhibits high lipophilicity due to the presence of fluorinated substituents, which can enhance its stability and reactivity in various chemical environments. The trifluoromethyl groups contribute to its unique electronic properties, making it a potential candidate for applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the presence of the ketone functional group suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound's physical properties, such as melting point, boiling point, and solubility, are influenced by its fluorinated structure, which often leads to lower volatility and increased resistance to degradation. Overall, this compound's distinctive characteristics make it of interest in both research and industrial applications.
Formula:C16H7F9O2
InChI:InChI=1S/C16H7F9O2/c17-14(18,19)10-5-9(6-11(7-10)15(20,21)22)13(26)8-1-3-12(4-2-8)27-16(23,24)25/h1-7H
InChI key:InChIKey=FZZLGZXGXJBXQS-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)C2=CC=C(OC(F)(F)F)C=C2
Synonyms:
  • [3,5-Bis(trifluoromethyl)phenyl][4-(trifluoromethoxy)phenyl]methanone
  • [3,5-Di(Trifluoromethyl)Phenyl][4-(Trifluoromethoxy)Phenyl]Methanone
  • Methanone, [3,5-bis(trifluoromethyl)phenyl][4-(trifluoromethoxy)phenyl]-
Found 1 products.