CAS 257933-82-7: Pelitinib
Description:Pelitinib is a small molecule inhibitor primarily designed to target the epidermal growth factor receptor (EGFR), which plays a crucial role in the proliferation and survival of cancer cells. It is classified as a tyrosine kinase inhibitor and is particularly relevant in the treatment of certain types of cancers, including non-small cell lung cancer. Pelitinib exhibits selectivity for the mutant forms of EGFR, which are often associated with resistance to other therapies. The compound's mechanism of action involves the inhibition of downstream signaling pathways that promote tumor growth and metastasis. In terms of its chemical properties, Pelitinib has a specific molecular structure that contributes to its biological activity, although detailed physicochemical properties such as solubility, stability, and bioavailability are essential for its therapeutic efficacy. Clinical studies have explored its potential benefits and side effects, contributing to the understanding of its role in targeted cancer therapy. As with any investigational drug, ongoing research continues to evaluate its effectiveness and safety profile in various patient populations.
Formula:C24H23ClFN5O2
InChI:InChI=1S/C24H23ClFN5O2/c1-4-33-22-12-20-17(11-21(22)30-23(32)6-5-9-31(2)3)24(15(13-27)14-28-20)29-16-7-8-19(26)18(25)10-16/h5-8,10-12,14H,4,9H2,1-3H3,(H,28,29)(H,30,32)/b6-5+
InChI key:InChIKey=WVUNYSQLFKLYNI-AATRIKPKSA-N
SMILES:N#CC1=CN=C2C=C(OCC)C(=CC2=C1NC3=CC=C(F)C(Cl)=C3)NC(=O)C=CCN(C)C
- Synonyms:
- (2E)-N-[4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl]-4-(dimethylamino)-2-butenamide
- (2E)-N-{4-[(3-chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxyquinolin-6-yl}-4-(dimethylamino)but-2-enamide
- (E)-N-(4-(3-chloro-4-fluorophenylamino)-3-cyano-7-ethoxyquinolin-6-yl)-4-(dimethylamino)but-2-enamide
- 2-Butenamide, N-[4-[(3-chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl]-4-(dimethylamino)-, (2E)-
- Ekb-569
- Way-Ekb 569
- Pelitinib
