CAS 25803-21-8

[3-(4-fluorobenzoyl)-6-methoxy-2-methyl-1H-indol-1-yl]acetic acid

Description:

The chemical substance known as [3-(4-fluorobenzoyl)-6-methoxy-2-methyl-1H-indol-1-yl]acetic acid, with the CAS number 25803-21-8, is an indole derivative that exhibits a complex structure characterized by the presence of an indole ring, a methoxy group, and a fluorobenzoyl moiety. This compound is typically recognized for its potential biological activity, which may include anti-inflammatory or anticancer properties, although specific pharmacological effects can vary based on the context of its use. The presence of the fluorobenzoyl group may enhance lipophilicity, potentially influencing its interaction with biological targets. Additionally, the carboxylic acid functional group contributes to its solubility in polar solvents and may play a role in its reactivity and biological interactions. Overall, this compound represents a class of molecules that are of interest in medicinal chemistry and drug development, warranting further investigation into its properties and applications.

Formula: C₁₉H₁₆FNO₄

InChI: InChI=1/C19H16FNO4/c1-11-18(19(24)12-3-5-13(20)6-4-12)15-8-7-14(25-2)9-16(15)21(11)10-17(22)23/h3-9H,10H2,1-2H3,(H,22,23)

SMILES: Cc1c(c2ccc(cc2n1CC(=O)O)OC)C(=O)c1ccc(cc1)F

3-(4-Fluorobenzoyl)-6-Methoxy-2-Methyl-1H-Indole-1-Acetic Acid

Controlled Product

CAS: 25803-21-8

3-(4-Fluorobenzoyl)-6-Methoxy-2-Methyl-1H-Indole-1-Acetic Acid is a prodrug that is metabolized to 6-fluoro-3,4 dioxo tamoxifen in the liver. It has been shown to have anticholinergic, cytosolic calcium and c1-4 alkyl properties. 3-(4-Fluorobenzoyl)-6-Methoxy-2-Methylindole Acetic Acid also has a basic group, cyclopentane ring, and pyridine ring.

Formula: C₁₉H₁₆FNO₄

Purity: Min. 95%

Molecular weight: 341.33 g/mol

Ref: 3D-FF96867