CAS 2582-86-7
:(9R)-8,9-Dihydro-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-3H-phenaleno[1,2-b]furan-3-one
Description:
(9R)-8,9-Dihydro-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-3H-phenaleno[1,2-b]furan-3-one, with CAS number 2582-86-7, is a complex organic compound characterized by its unique polycyclic structure, which includes multiple hydroxyl groups and a furan moiety. This compound exhibits significant stereochemistry, particularly with the (9R) configuration, indicating the specific spatial arrangement of its atoms. The presence of multiple hydroxyl groups contributes to its potential solubility in polar solvents and may influence its reactivity and biological activity. Additionally, the tetramethyl groups suggest that the compound may have a bulky structure, which can affect its interactions with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, natural products, and materials science due to their intricate structures and functional groups. Understanding the properties and behavior of this compound requires further investigation into its chemical reactivity, stability, and potential uses in various fields.
Formula:C19H18O6
InChI:InChI=1/C19H18O6/c1-6-5-8(20)10-11-9(6)18-13(19(3,4)7(2)25-18)14(21)12(11)16(23)17(24)15(10)22/h5,7,21-24H,1-4H3/t7-/m1/s1
InChI key:InChIKey=BTQBPLOITIIODY-SSDOTTSWSA-N
SMILES:CC=1C=2C=3C(C(O)=C4C2O[C@H](C)C4(C)C)=C(O)C(O)=C(O)C3C(=O)C1
Synonyms:- 3H-Phenaleno(1,2-b)furan-3-one, 8,9-dihydro-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-, (R)-
- 5-Deoxynorherqueinone
- 3H-Phenaleno[1,2-b]furan-3-one, 8,9-dihydro-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-, (R)-
- Atrovenetin
- (9R)-8,9-Dihydro-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-3H-phenaleno[1,2-b]furan-3-one
- 3H-Phenaleno[1,2-b]furan-3-one, 8,9-dihydro-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-, (9R)-
- 4,5,6,7-Tetrahydroxy-1,8,8,9-tetramethyl-8,9-dihydrophenaleno[1,2-b]fu ran-3-one
- (R)-8,9-Dihydro-4,5,6,7-tetrahydroxy-1,8,8,9-tetramethyl-3H-phenaleno[1,2-b]furan-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Atrovenetin
CAS:Atrovenetin is an antibiotic found in Penicillium species (antibiotic). It exhibits inhibitory activity against Bacillus subtilis and Staphylococcus aureus. Atrovenetin is also a potent antioxidant.Formula:C19H18O6Color and Shape:SolidMolecular weight:342.343
