CAS 25844-72-8
:5-phenylpyrazin-2(1H)-one
Description:
5-Phenylpyrazin-2(1H)-one, with the CAS number 25844-72-8, is an organic compound characterized by its pyrazinone structure, which features a pyrazine ring substituted with a phenyl group. This compound typically exhibits a solid state at room temperature and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the phenyl group enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. In terms of solubility, it is generally soluble in organic solvents but may have limited solubility in water. The compound's reactivity can be attributed to the carbonyl group in the pyrazinone moiety, making it a candidate for various chemical transformations. Additionally, its structural features allow for potential applications in medicinal chemistry and material science. As with many organic compounds, safety precautions should be taken when handling 5-phenylpyrazin-2(1H)-one, as its toxicity profile should be evaluated in specific contexts.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c13-10-7-11-9(6-12-10)8-4-2-1-3-5-8/h1-7H,(H,12,13)
SMILES:c1ccc(cc1)c1c[nH]c(=O)cn1
Synonyms:- 2(1H)-pyrazinone, 5-phenyl-
- 5-Phenyl-2(1H)-pyrazinon
- 5-Phenyl-2(1H)-pyrazinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Phenyl-1H-pyrazin-2-one
CAS:5-Phenyl-1H-pyrazin-2-one is a potent inhibitor of tyrosine kinase, which is an enzyme that regulates the activity of cells by transferring phosphate groups from ATP to tyrosine residues. This drug binds to the ATP binding site, resulting in inhibition of the enzyme's activity and reduced cell proliferation. 5-Phenyl-1H-pyrazin-2-one has been shown to be effective in treating rheumatoid arthritis and other autoimmune diseases, with no adverse effects on bone metabolism or blood pressure. It also has no effect on platelet aggregation or erythrocytes.
Formula:C10H8N2OPurity:Min. 95%Molecular weight:172.18 g/mol

