CAS 25844-73-9

2-chloro-5-phenylpyrazine

Description:

2-Chloro-5-phenylpyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the second position and a phenyl group at the fifth position of the pyrazine ring contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure allows for various chemical reactions, including electrophilic substitution due to the electron-withdrawing nature of the chlorine atom. 2-Chloro-5-phenylpyrazine is of interest in pharmaceutical and agrochemical research, as it may serve as a building block for the synthesis of more complex molecules. Additionally, its potential biological activity makes it a subject of investigation in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₇ClN₂

InChI: InChI=1/C10H7ClN2/c11-10-7-12-9(6-13-10)8-4-2-1-3-5-8/h1-7H

SMILES: c1ccc(cc1)c1cnc(cn1)Cl

Synonyms:

• 2-Chlor-5-phenylpyrazin
• Pyrazine, 2-Chloro-5-Phenyl-
• 2-Chloro-5-phenylpyrazine

2-Chloro-5-phenylpyrazine

CAS: 25844-73-9

Formula: C₁₀H₇ClN₂

Molecular weight: 190.6290

Ref: IN-DA00C1QF

2-Chloro-5-phenylpyrazine

CAS: 25844-73-9

2-Chloro-5-phenylpyrazine

Purity: 95%

Color and Shape: Solid

Molecular weight: 190.63g/mol

Ref: 54-OR480225

2-chloro-5-phenylpyrazine

CAS: 25844-73-9

Formula: C₁₀H₇ClN₂

Purity: 95.0%

Molecular weight: 190.63

Ref: 10-F526471

2-Chloro-5-phenylpyrazine

CAS: 25844-73-9

2-Chloro-5-phenylpyrazine (2CPP) is an amide nucleophile that reacts with diphenyl to form the corresponding diphenyl amide. 2CPP is a nucleophilic compound that yields the product in high yields. The attack of the nucleophile on the electrophilic carbon atom generates a new carbon-nucleus bond, and another molecule of 2CPP or other nucleophile can attack the same carbon atom to produce a second product. 2CPP reacts with potassium to form a white solid, which is then heated to release hydrogen chloride gas.

Formula: C₁₀H₇ClN₂

Purity: Min. 95%

Molecular weight: 190.63 g/mol

Ref: 3D-ABA84473