CAS 2585-26-4

N-benzyl-4-nitrobenzamide

Description:

N-benzyl-4-nitrobenzamide is an organic compound characterized by its structure, which includes a benzyl group and a nitro-substituted aromatic ring. It features a carbonyl group (amide) linked to a benzene ring, making it part of the amide functional group. The presence of the nitro group (-NO2) at the para position relative to the amide enhances its electrophilic properties, potentially influencing its reactivity in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals, given the significance of nitro and amide functionalities in medicinal chemistry. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and handling protocols are essential to mitigate risks associated with exposure.

Formula: C₁₄H₁₂N₂O₃

InChI: InChI=1/C14H12N2O3/c17-14(15-10-11-4-2-1-3-5-11)12-6-8-13(9-7-12)16(18)19/h1-9H,10H2,(H,15,17)

Synonyms:

• benzamide, 4-nitro-N-(phenylmethyl)-

(4-Nitrophenyl)-N-benzylformamide

CAS: 2585-26-4

4-Nitrophenyl-N-benzylformamide is a heterocycle that is a reactive, biomolecular building block with reactive groups. It has been shown to react with primary alcohols and amines to form mesoporous silica materials. This compound reacts with chlorides in the presence of phosphine to form 4-nitrophenylchloroformate. The product is an acylating agent that can react with amides or thiocarbamates to form amide or thiocarbamic esters respectively.

Formula: C₁₄H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 256.26 g/mol

Ref: 3D-CAA58526