CAS 258506-68-2: 3-Chloro-6-(trifluoromethyl)pyridazine
Description:3-Chloro-6-(trifluoromethyl)pyridazine is a heterocyclic organic compound characterized by a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of a chlorine atom at the 3-position and a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow solid, exhibiting moderate solubility in organic solvents. The trifluoromethyl group enhances its lipophilicity and can impart unique electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. The chlorine substituent can also affect the compound's reactivity, potentially allowing for further functionalization. Additionally, 3-Chloro-6-(trifluoromethyl)pyridazine may exhibit biological activity, which warrants investigation in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a valuable structure in the field of synthetic organic chemistry.
Formula:C5H2ClF3N2
InChI:InChI=1S/C5H2ClF3N2/c6-4-2-1-3(10-11-4)5(7,8)9/h1-2H
InChI key:InChIKey=AZNKQIFEMQHORS-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=NN=C(Cl)C=C1
- Synonyms:
- 3-chloro-6-(trifluoromethyl)pyridazine
- Pyridazine, 3-chloro-6-(trifluoromethyl)-
- 3-Chloro-6-(trifluoromethyl)pyridazine

3-Chloro-6-(trifluoromethyl)pyridazine
Ref: IN-DA003J9U
1g | 40.00 € | ||
5g | 114.00 € | ||
10g | 165.00 € | ||
25g | 291.00 € | ||
100g | To inquire | ||
250mg | 26.00 € |

3-Chloro-6-trifluoromethylpyridazine
Ref: 10-F036209
1g | 23.00 € | ||
5g | 83.00 € | ||
10g | 141.00 € | ||
25g | 306.00 € |

3-Chloro-6-(trifluoromethyl)pyridazine
Ref: 54-PC5684
1g | 80.00 € | ||
5g | 225.00 € | ||
250mg | 47.00 € |

3-chloro-6-(trifluoromethyl)pyridazine
Ref: 3D-FC105059
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |