
CAS 258516-82-4
:2-(Chloromethoxy)-1,3-bis(1-methylethyl)benzene
Description:
2-(Chloromethoxy)-1,3-bis(1-methylethyl)benzene, identified by its CAS number 258516-82-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a chloromethoxy group and two isopropyl groups. The presence of the chloromethoxy group introduces a chlorine atom and a methoxy functional group, which can influence the compound's reactivity and polarity. The isopropyl groups contribute to the steric bulk and hydrophobic character of the molecule, potentially affecting its solubility in various solvents. This compound may exhibit interesting chemical properties, such as reactivity in electrophilic aromatic substitution reactions due to the electron-donating effects of the isopropyl groups. Additionally, the chloromethoxy substituent can participate in nucleophilic substitution reactions. Overall, the unique combination of functional groups in 2-(Chloromethoxy)-1,3-bis(1-methylethyl)benzene suggests potential applications in organic synthesis and materials science, although specific applications would depend on further research and exploration of its properties.
Formula:C13H19ClO
InChI:InChI=1S/C13H19ClO/c1-9(2)11-6-5-7-12(10(3)4)13(11)15-8-14/h5-7,9-10H,8H2,1-4H3
InChI key:InChIKey=XYMTUFXXCMZHCU-UHFFFAOYSA-N
SMILES:O(CCl)C1=C(C(C)C)C=CC=C1C(C)C
Synonyms:- 2-(Chloromethoxy)-1,3-bis(propan-2-yl)benzene
- Chloromethyl 2,6-diisopropylphenyl ether
- Benzene, 2-(chloromethoxy)-1,3-bis(1-methylethyl)-
- 2-(Chloromethoxy)-1,3-bis(1-methylethyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
