CAS 258530-60-8: (1-oxidothiomorpholin-4-yl)acetic acid

Description:(1-Oxidothiomorpholin-4-yl)acetic acid is a chemical compound characterized by its unique structure, which includes a morpholine ring with a sulfur atom and an acetic acid functional group. This compound typically exhibits properties associated with both thiol and carboxylic acid functionalities, making it potentially useful in various chemical reactions and applications. The presence of the morpholine ring contributes to its cyclic structure, which can influence its solubility and reactivity. As a derivative of morpholine, it may exhibit biological activity, potentially serving as a scaffold for drug development or as a reagent in organic synthesis. The compound's CAS number, 258530-60-8, allows for precise identification in chemical databases. Its stability, reactivity, and potential interactions with other molecules would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents. Overall, (1-oxidothiomorpholin-4-yl)acetic acid represents a versatile compound with applications in medicinal chemistry and synthetic organic chemistry.

Formula:C₆H₁₁NO₃S

InChI:InChI=1/C6H11NO3S/c8-6(9)5-7-1-3-11(10)4-2-7/h1-5H2,(H,8,9)

Synonyms:
(1-Oξdothiomorpholin-4-yl)acetic acid
4-Thiomorpholine acetic acid, 1-oxide
4-Thiomorpholineacetic Acid, 1-Oxide

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-(1-Oxidothiomorpholino)acetic acid REF: 10-F740501CAS: 258530-60-8	98%	- - -	Discontinued product
	4-Thiomorpholineacetic acid REF: 3D-IKA53060CAS: 258530-60-8	Min. 95%	- - -	Discontinued product