CAS 25859-29-4
:Decanoic acid, compd. with 2-aminoethanol (1:1)
Description:
Decanoic acid, compd. with 2-aminoethanol (1:1), also known as decanoic acid 2-aminoethanol salt, is a chemical compound characterized by its formation from the reaction between decanoic acid, a medium-chain fatty acid, and 2-aminoethanol, an amino alcohol. This compound typically appears as a white to off-white solid or viscous liquid, depending on the specific conditions and purity. It exhibits amphiphilic properties due to the presence of both hydrophobic (the decanoic acid moiety) and hydrophilic (the aminoethanol moiety) components, making it useful in various applications, including surfactants and emulsifiers. The compound is soluble in water and organic solvents, which enhances its versatility in formulations. Additionally, it may exhibit biological activity, potentially serving as a surfactant or stabilizing agent in pharmaceutical and cosmetic formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H20O2·C2H7NO
InChI:InChI=1S/C10H20O2.C2H7NO/c1-2-3-4-5-6-7-8-9-10(11)12;3-1-2-4/h2-9H2,1H3,(H,11,12);4H,1-3H2
InChI key:InChIKey=VRUZHFPWMNICEL-UHFFFAOYSA-N
SMILES:C(CCCCCC)CCC(O)=O.C(CO)N
Synonyms:- Decanoic acid, compound with 2-aminoethanol (1:1)
- Decanoic acid, compd. with 2-aminoethanol (1:1)
- 2-hydroxyethanaminium decanoate
- Ethanol, 2-amino-, decanoate (salt)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Monoethanolamine caprate
CAS:<p>Monoethanolamine caprate is a biochemical.</p>Formula:C12H27NO3Color and Shape:SolidMolecular weight:233.35
