CAS 2587-03-3

2-(2,6-dichloropyridin-4-yl)-1-hydroxy-1-oxodiazanium

Description:

2-(2,6-Dichloropyridin-4-yl)-1-hydroxy-1-oxodiazanium, with the CAS number 2587-03-3, is a chemical compound characterized by its unique structure that includes a pyridine ring substituted with two chlorine atoms and a hydroxy group. This compound features a diazonium functional group, which is known for its reactivity, particularly in electrophilic aromatic substitution reactions. The presence of the dichloropyridine moiety contributes to its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The hydroxy group enhances its solubility in polar solvents, making it suitable for various chemical reactions. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine substituents, which can modulate the electron density on the aromatic ring. Overall, this compound exemplifies the interplay between structure and reactivity in organic chemistry, making it a subject of interest for further research and application in synthetic methodologies.

Formula: C₅H₄Cl₂N₃O₂

InChI: InChI=1/C5H4Cl2N3O2/c6-4-1-3(9-10(11)12)2-5(7)8-4/h1-2H,(H,8,9)(H,11,12)/q+1

SMILES: c1c(cc(Cl)nc1Cl)NN(=O)O

2,6-Dichloro-4-nitraminopyridine

Controlled Product

CAS: 2587-03-3

Applications 2,6-Dichloro-4-nitraminopyridine (cas# 2587-03-3) is a compound useful in organic synthesis.

Formula: C₅H₃Cl₂N₃O₂

Color and Shape: Neat

Molecular weight: 208.00

Ref: TR-D435615