CAS 2587-46-4
:1,2,3,4,5,6-Hexamethylcyclotrisilazane
Description:
1,2,3,4,5,6-Hexamethylcyclotrisilazane, with the CAS number 2587-46-4, is a cyclic silazane compound characterized by its unique structure, which consists of a three-membered silazane ring with six methyl groups attached to the nitrogen atoms. This compound is notable for its thermal stability and potential applications in materials science, particularly in the development of silicone-based polymers and coatings. The presence of multiple methyl groups enhances its hydrophobic properties, making it useful in applications requiring water resistance. Additionally, the cyclic nature of the molecule contributes to its rigidity and stability under various conditions. Hexamethylcyclotrisilazane can be synthesized through specific chemical reactions involving silanes and amines, and it is often studied for its reactivity and potential as a precursor in the synthesis of more complex silazane and silicone materials. Safety data indicates that, like many silazanes, it should be handled with care due to potential irritant properties.
Formula:C6H21N3Si3
InChI:InChI=1S/C6H21N3Si3/c1-7-10(4)8(2)12(6)9(3)11(7)5/h10-12H,1-6H3
InChI key:InChIKey=HBNWIPMCQKVDDD-UHFFFAOYSA-N
SMILES:CN1[SiH](C)N(C)[SiH](C)N(C)[SiH]1C
Synonyms:- 1,2,3,4,5,6-Hexamethyl-1,3,5,2,4,6-Triazatrisilinane-2,4,6-Triyl
- 1,2,3,4,5,6-Hexamethylcyclotrisilazane
- Cyclotrisilazane, 1,2,3,4,5,6-hexamethyl-
- 1,2,3,4,5,6-Hexamethyl-1,3,5,2,4,6-triazatrisilinane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,3,4,5,6 HEXAMETHYLCYCLOTRISILAZANE, tech
CAS:Formula:C6H21N3Si3Purity:techColor and Shape:LiquidMolecular weight:219.51
