
CAS 2587-90-8
:Demephion-S
Description:
Demephion-S, with the CAS number 2587-90-8, is an organophosphorus compound primarily used as an insecticide and acaricide in agricultural applications. It is characterized by its ability to inhibit acetylcholinesterase, an enzyme critical for the proper functioning of the nervous system in insects, leading to paralysis and death. Demephion-S is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water. The compound is known for its moderate toxicity to humans and other non-target organisms, necessitating careful handling and application to minimize environmental impact. Its use is regulated in many countries due to potential health risks and environmental concerns. As with other organophosphates, safety measures, including personal protective equipment, are recommended during its application to mitigate exposure risks. Overall, Demephion-S exemplifies the dual nature of agricultural chemicals, providing pest control benefits while posing challenges related to safety and environmental sustainability.
Formula:C5H13O3PS2
InChI:InChI=1S/C5H13O3PS2/c1-7-9(6,8-2)11-5-4-10-3/h4-5H2,1-3H3
InChI key:InChIKey=PSTWJANBJOHFQJ-UHFFFAOYSA-N
SMILES:P(SCCSC)(OC)(OC)=O
Synonyms:- Demephion-S
- Phosphorothioic acid, O,O-dimethyl S-[2-(methylthio)ethyl] ester
- Isotinox
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Demephion-S
CAS:Controlled ProductFormula:C5H13O3PS2Color and Shape:Colourless To Light YellowMolecular weight:216.26

