CAS 25876-45-3
:[(3R,6S)-3,4,5-triacetoxy-6-(4-acetylphenoxy)tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3R,6S)-3,4,5-triacetoxy-6-(4-acetylphenoxy)tetrahydropyran-2-yl]methyl acetate" and CAS number 25876-45-3 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple acetoxy groups, indicating the presence of acetyl functional groups that contribute to its reactivity and solubility properties. The presence of a phenoxy group, specifically a 4-acetylphenoxy moiety, suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The stereochemistry indicated by the (3R,6S) configuration implies specific spatial arrangements of atoms, which can significantly influence the compound's biological activity and interactions. Additionally, the methyl acetate group enhances its volatility and may affect its solubility in organic solvents. Overall, this compound's unique structural features and functional groups make it of interest for various chemical applications, including synthesis and research in organic chemistry.
Formula:C22H26O11
InChI:InChI=1/C22H26O11/c1-11(23)16-6-8-17(9-7-16)32-22-21(31-15(5)27)20(30-14(4)26)19(29-13(3)25)18(33-22)10-28-12(2)24/h6-9,18-22H,10H2,1-5H3/t18?,19-,20?,21?,22-/m1/s1
SMILES:CC(=O)c1ccc(cc1)O[C@H]1C(C([C@@H](C(COC(=O)C)O1)OC(=O)C)OC(=O)C)OC(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Acetylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside
CAS:4-Acetylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside is a diagnostic marker for cancer. It is an exosome biomarker that can be used to diagnose and measure the progression of cancer. The measurement of this substance provides a new way to detect and diagnose cancers. This compound has been found in diagnostics samples from patients with lung cancer, colorectal cancer, prostate cancer and breast cancer. 4-Acetylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside is an example of a type of molecule called mirnas that regulate gene expression by binding to messenger RNA (mRNA). Mirnas are used as biomarkers in the diagnosis of cancers because they are over expressed or under expressed in cancers compared to normal cells.Formula:C22H26O11Purity:Min. 95%Molecular weight:466.45 g/mol

