CAS 25888-01-1

5-hydroxy-1,2-dimethyl-1H-indole-3-carboxylic acid

Description:

5-Hydroxy-1,2-dimethyl-1H-indole-3-carboxylic acid, with the CAS number 25888-01-1, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) that contribute to its polar nature, enhancing its solubility in water. The presence of two methyl groups at the 1 and 2 positions of the indole ring influences its chemical reactivity and biological activity. This compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential pharmacological properties. It may exhibit antioxidant, anti-inflammatory, or other biological activities, making it a subject of research in drug development. Additionally, its structural characteristics allow for various synthetic modifications, which can lead to derivatives with enhanced or altered properties. Overall, 5-hydroxy-1,2-dimethyl-1H-indole-3-carboxylic acid represents a significant compound for further exploration in chemical and biological research.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1/C11H11NO3/c1-6-10(11(14)15)8-5-7(13)3-4-9(8)12(6)2/h3-5,13H,1-2H3,(H,14,15)

SMILES: Cc1c(c2cc(ccc2n1C)O)C(=O)O

Synonyms:

• 1H-indole-3-carboxylic acid, 5-hydroxy-1,2-dimethyl-
• Arbidol Impurity 12
• 5-hydroxy-1,2-dimethyl-1H-indole-3-carboxylic acid(SALTDATA: FREE)

5-Hydroxy-1,2-dimethyl-1H-indole-3-carboxylic acid

CAS: 25888-01-1

Formula: C₁₁H₁₁NO₃

Purity: 95.0%

Molecular weight: 205.213

Ref: 10-F055600